C16H14F2O — CID 116531754
5-fluoro-1-(4-fluoro-3-methylphenyl)-2,3-dihydroinden-1-ol (PubChem CID 116531754) has the molecular formula C16H14F2O and a molecular weight of 260.28 g/mol. Its IUPAC name is 5-fluoro-1-(4-fluoro-3-methylphenyl)-2,3-dihydroinden-1-ol.
| Compound Name | 5-fluoro-1-(4-fluoro-3-methylphenyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 116531754 |
| Molecular Formula | C16H14F2O |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5-fluoro-1-(4-fluoro-3-methylphenyl)-2,3-dihydroinden-1-ol |
| SMILES | Cc1cc(C2(O)CCc3cc(F)ccc32)ccc1F |
| InChI | InChI=1S/C16H14F2O/c1-10-8-12(2-5-15(10)18)16(19)7-6-11-9-13(17)3-4-14(11)16/h2-5,8-9,19H,6-7H2,1H3 |
| InChIKey | JZNXYIYLYYEBSN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |