C13H11BrFNS — CID 116532011
1-(4-bromothiophen-3-yl)-5-fluoro-2,3-dihydroinden-1-amine (PubChem CID 116532011) has the molecular formula C13H11BrFNS and a molecular weight of 312.21 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-5-fluoro-2,3-dihydroinden-1-amine.
| Compound Name | 1-(4-bromothiophen-3-yl)-5-fluoro-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 116532011 |
| Molecular Formula | C13H11BrFNS |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-5-fluoro-2,3-dihydroinden-1-amine |
| SMILES | NC1(c2cscc2Br)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C13H11BrFNS/c14-12-7-17-6-11(12)13(16)4-3-8-5-9(15)1-2-10(8)13/h1-2,5-7H,3-4,16H2 |
| InChIKey | WOERYISODJJPMB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |