About 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine
1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine (PubChem CID 55120511) has the molecular formula C15H13F2N
and a molecular weight of 245.27 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine.
Molecular Properties
| Compound Name | 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine |
| PubChem CID | 55120511 |
| Molecular Formula | C15H13F2N |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine |
| SMILES | NC1(c2ccc(F)cc2F)CCc2ccccc21 |
| InChI | InChI=1S/C15H13F2N/c16-11-5-6-13(14(17)9-11)15(18)8-7-10-3-1-2-4-12(10)15/h1-6,9H,7-8,18H2 |
| InChIKey | AUBBRIDVDTWCGU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine?
The IUPAC name of 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine (CID 55120511) is 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine.
What is the SMILES notation for 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine?
The canonical SMILES for 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine is NC1(c2ccc(F)cc2F)CCc2ccccc21.
What is the InChIKey of 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine?
The InChIKey is AUBBRIDVDTWCGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2N/c16-11-5-6-13(14(17)9-11)15(18)8-7-10-3-1-2-4-12(10)15/h1-6,9H,7-8,18H2.
What are the key properties of 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine?
1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine has a molecular weight of 245.27 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)-2,3-dihydroinden-1-amine is sourced from PubChem (CID 55120511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).