C16H15ClFNO — CID 116532012
1-(4-chloro-3-methoxyphenyl)-5-fluoro-2,3-dihydroinden-1-amine (PubChem CID 116532012) has the molecular formula C16H15ClFNO and a molecular weight of 291.75 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-5-fluoro-2,3-dihydroinden-1-amine.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-5-fluoro-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 116532012 |
| Molecular Formula | C16H15ClFNO |
| Molecular Weight | 291.75 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-5-fluoro-2,3-dihydroinden-1-amine |
| SMILES | COc1cc(C2(N)CCc3cc(F)ccc32)ccc1Cl |
| InChI | InChI=1S/C16H15ClFNO/c1-20-15-9-11(2-5-14(15)17)16(19)7-6-10-8-12(18)3-4-13(10)16/h2-5,8-9H,6-7,19H2,1H3 |
| InChIKey | UZYGLFFOQQBLEP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.75 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |