C17H18FNO2 — CID 79371978
1-(3-fluoro-4-methoxyphenyl)-6-methoxy-2,3-dihydroinden-1-amine (PubChem CID 79371978) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-6-methoxy-2,3-dihydroinden-1-amine.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-6-methoxy-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 79371978 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-6-methoxy-2,3-dihydroinden-1-amine |
| SMILES | COc1ccc2c(c1)C(N)(c1ccc(OC)c(F)c1)CC2 |
| InChI | InChI=1S/C17H18FNO2/c1-20-13-5-3-11-7-8-17(19,14(11)10-13)12-4-6-16(21-2)15(18)9-12/h3-6,9-10H,7-8,19H2,1-2H3 |
| InChIKey | ZLNOHUUDVGHJMH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |