C15H17NOS — CID 79375071
6-methoxy-1-(5-methylthiophen-3-yl)-2,3-dihydroinden-1-amine (PubChem CID 79375071) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is 6-methoxy-1-(5-methylthiophen-3-yl)-2,3-dihydroinden-1-amine.
| Compound Name | 6-methoxy-1-(5-methylthiophen-3-yl)-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 79375071 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 6-methoxy-1-(5-methylthiophen-3-yl)-2,3-dihydroinden-1-amine |
| SMILES | COc1ccc2c(c1)C(N)(c1csc(C)c1)CC2 |
| InChI | InChI=1S/C15H17NOS/c1-10-7-12(9-18-10)15(16)6-5-11-3-4-13(17-2)8-14(11)15/h3-4,7-9H,5-6,16H2,1-2H3 |
| InChIKey | ZQQITMLKDWTMMP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |