About 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline
6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline (PubChem CID 167276791) has the molecular formula C10H12FNS
and a molecular weight of 197.28 g/mol. Its IUPAC name is 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 167276791 |
| Molecular Formula | C10H12FNS |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline |
| SMILES | CSN1CCCc2cc(F)ccc21 |
| InChI | InChI=1S/C10H12FNS/c1-13-12-6-2-3-8-7-9(11)4-5-10(8)12/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | HKDVIQZGSTXHSC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline?
The IUPAC name of 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline (CID 167276791) is 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline is CSN1CCCc2cc(F)ccc21.
What is the InChIKey of 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline?
The InChIKey is HKDVIQZGSTXHSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNS/c1-13-12-6-2-3-8-7-9(11)4-5-10(8)12/h4-5,7H,2-3,6H2,1H3.
What are the key properties of 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline?
6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline has a molecular weight of 197.28 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 167276791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).