C10H12FNS — CID 167276791
6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline (PubChem CID 167276791) has the molecular formula C10H12FNS and a molecular weight of 197.28 g/mol. Its IUPAC name is 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline.
| Compound Name | 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 167276791 |
| Molecular Formula | C10H12FNS |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 6-fluoro-1-methylsulfanyl-3,4-dihydro-2H-quinoline |
| SMILES | CSN1CCCc2cc(F)ccc21 |
| InChI | InChI=1S/C10H12FNS/c1-13-12-6-2-3-8-7-9(11)4-5-10(8)12/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | HKDVIQZGSTXHSC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|