C17H12F2OS — CID 64559645
1-(1-benzothiophen-3-yl)-3-(2,4-difluorophenyl)propan-2-one (PubChem CID 64559645) has the molecular formula C17H12F2OS and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-3-(2,4-difluorophenyl)propan-2-one.
| Compound Name | 1-(1-benzothiophen-3-yl)-3-(2,4-difluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 64559645 |
| Molecular Formula | C17H12F2OS |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-3-(2,4-difluorophenyl)propan-2-one |
| SMILES | O=C(Cc1ccc(F)cc1F)Cc1csc2ccccc12 |
| InChI | InChI=1S/C17H12F2OS/c18-13-6-5-11(16(19)9-13)7-14(20)8-12-10-21-17-4-2-1-3-15(12)17/h1-6,9-10H,7-8H2 |
| InChIKey | QTKWMXQNRLVCHY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |