C10H13BClNO2 — CID 90145687
1-[(5-chloro-3H-2,1-benzoxaborol-1-yl)amino]propan-2-ol (PubChem CID 90145687) has the molecular formula C10H13BClNO2 and a molecular weight of 225.48 g/mol. Its IUPAC name is 1-[(5-chloro-3H-2,1-benzoxaborol-1-yl)amino]propan-2-ol.
| Compound Name | 1-[(5-chloro-3H-2,1-benzoxaborol-1-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 90145687 |
| Molecular Formula | C10H13BClNO2 |
| Molecular Weight | 225.48 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 1-[(5-chloro-3H-2,1-benzoxaborol-1-yl)amino]propan-2-ol |
| SMILES | CC(O)CNB1OCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H13BClNO2/c1-7(14)5-13-11-10-3-2-9(12)4-8(10)6-15-11/h2-4,7,13-14H,5-6H2,1H3 |
| InChIKey | MASCRNGIOACPOT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.48 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|