C17H16BNO5 — CID 88865499
[2-formamido-5-[(1-methyl-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methyl formate (PubChem CID 88865499) has the molecular formula C17H16BNO5 and a molecular weight of 325.13 g/mol. Its IUPAC name is [2-formamido-5-[(1-methyl-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methyl formate.
| Compound Name | [2-formamido-5-[(1-methyl-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methyl formate |
|---|---|
| PubChem CID | 88865499 |
| Molecular Formula | C17H16BNO5 |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [2-formamido-5-[(1-methyl-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methyl formate |
| SMILES | CB1OCc2cc(Oc3ccc(NC=O)c(COC=O)c3)ccc21 |
| InChI | InChI=1S/C17H16BNO5/c1-18-16-4-2-14(6-12(16)9-23-18)24-15-3-5-17(19-10-20)13(7-15)8-22-11-21/h2-7,10-11H,8-9H2,1H3,(H,19,20) |
| InChIKey | NHLCIFUWZQWFQG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|