C15H13BF3NO4S — CID 59525448
N-(1-methyl-3H-2,1-benzoxaborol-6-yl)-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 59525448) has the molecular formula C15H13BF3NO4S and a molecular weight of 371.15 g/mol. Its IUPAC name is N-(1-methyl-3H-2,1-benzoxaborol-6-yl)-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(1-methyl-3H-2,1-benzoxaborol-6-yl)-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 59525448 |
| Molecular Formula | C15H13BF3NO4S |
| Molecular Weight | 371.15 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-(1-methyl-3H-2,1-benzoxaborol-6-yl)-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CB1OCc2ccc(NS(=O)(=O)c3ccc(OC(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C15H13BF3NO4S/c1-16-14-8-11(3-2-10(14)9-23-16)20-25(21,22)13-6-4-12(5-7-13)24-15(17,18)19/h2-8,20H,9H2,1H3 |
| InChIKey | SILYGEYNOJXGIC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|