C14H10BNO3S — CID 70897480
2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole (PubChem CID 70897480) has the molecular formula C14H10BNO3S and a molecular weight of 283.12 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole.
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole |
|---|---|
| PubChem CID | 70897480 |
| Molecular Formula | C14H10BNO3S |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole |
| SMILES | OB1OCc2ccc(Oc3nc4ccccc4s3)cc21 |
| InChI | InChI=1S/C14H10BNO3S/c17-15-11-7-10(6-5-9(11)8-18-15)19-14-16-12-3-1-2-4-13(12)20-14/h1-7,17H,8H2 |
| InChIKey | XCTMITHTZZVIGG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|