About 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole
2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole (PubChem CID 70897480) has the molecular formula C14H10BNO3S
and a molecular weight of 283.12 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole |
| PubChem CID | 70897480 |
| Molecular Formula | C14H10BNO3S |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole |
| SMILES | OB1OCc2ccc(Oc3nc4ccccc4s3)cc21 |
| InChI | InChI=1S/C14H10BNO3S/c17-15-11-7-10(6-5-9(11)8-18-15)19-14-16-12-3-1-2-4-13(12)20-14/h1-7,17H,8H2 |
| InChIKey | XCTMITHTZZVIGG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole?
The IUPAC name of 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole (CID 70897480) is 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole.
What is the SMILES notation for 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole?
The canonical SMILES for 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole is OB1OCc2ccc(Oc3nc4ccccc4s3)cc21.
What is the InChIKey of 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole?
The InChIKey is XCTMITHTZZVIGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BNO3S/c17-15-11-7-10(6-5-9(11)8-18-15)19-14-16-12-3-1-2-4-13(12)20-14/h1-7,17H,8H2.
What are the key properties of 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole?
2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole has a molecular weight of 283.12 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-1,3-benzothiazole is sourced from PubChem (CID 70897480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).