About N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide
N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide (PubChem CID 163704257) has the molecular formula C14H13N5OS
and a molecular weight of 299.36 g/mol. Its IUPAC name is N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide.
Molecular Properties
| Compound Name | N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide |
| PubChem CID | 163704257 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide |
| SMILES | NN=C(NN)c1ccc(Oc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C14H13N5OS/c15-18-13(19-16)9-5-7-10(8-6-9)20-14-17-11-3-1-2-4-12(11)21-14/h1-8H,15-16H2,(H,18,19) |
| InChIKey | KDQUAAYDVUZMQX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide?
The IUPAC name of N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide (CID 163704257) is N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide.
What is the SMILES notation for N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide?
The canonical SMILES for N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide is NN=C(NN)c1ccc(Oc2nc3ccccc3s2)cc1.
What is the InChIKey of N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide?
The InChIKey is KDQUAAYDVUZMQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5OS/c15-18-13(19-16)9-5-7-10(8-6-9)20-14-17-11-3-1-2-4-12(11)21-14/h1-8H,15-16H2,(H,18,19).
What are the key properties of N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide?
N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide has a molecular weight of 299.36 g/mol, XLogP of 2.17, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide is sourced from PubChem (CID 163704257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).