C14H13N5OS — CID 163704257
N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide (PubChem CID 163704257) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide.
| Compound Name | N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 163704257 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N,N'-diamino-4-(1,3-benzothiazol-2-yloxy)benzenecarboximidamide |
| SMILES | NN=C(NN)c1ccc(Oc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C14H13N5OS/c15-18-13(19-16)9-5-7-10(8-6-9)20-14-17-11-3-1-2-4-12(11)21-14/h1-8H,15-16H2,(H,18,19) |
| InChIKey | KDQUAAYDVUZMQX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|