C18H20N2OS — CID 154645733
4-[4-(1,3-benzothiazol-2-yloxy)phenyl]-N-methylbutan-2-amine (PubChem CID 154645733) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 4-[4-(1,3-benzothiazol-2-yloxy)phenyl]-N-methylbutan-2-amine.
| Compound Name | 4-[4-(1,3-benzothiazol-2-yloxy)phenyl]-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 154645733 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-[4-(1,3-benzothiazol-2-yloxy)phenyl]-N-methylbutan-2-amine |
| SMILES | CNC(C)CCc1ccc(Oc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C18H20N2OS/c1-13(19-2)7-8-14-9-11-15(12-10-14)21-18-20-16-5-3-4-6-17(16)22-18/h3-6,9-13,19H,7-8H2,1-2H3 |
| InChIKey | RZQNFHZLZUXIKB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |