C16H10N2O2S — CID 59577683
6-(1,3-benzothiazol-2-yloxy)-1H-indole-2-carbaldehyde (PubChem CID 59577683) has the molecular formula C16H10N2O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yloxy)-1H-indole-2-carbaldehyde.
| Compound Name | 6-(1,3-benzothiazol-2-yloxy)-1H-indole-2-carbaldehyde |
|---|---|
| PubChem CID | 59577683 |
| Molecular Formula | C16H10N2O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yloxy)-1H-indole-2-carbaldehyde |
| SMILES | O=Cc1cc2ccc(Oc3nc4ccccc4s3)cc2[nH]1 |
| InChI | InChI=1S/C16H10N2O2S/c19-9-11-7-10-5-6-12(8-14(10)17-11)20-16-18-13-3-1-2-4-15(13)21-16/h1-9,17H |
| InChIKey | SPXROLLNDLPZKW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|