About methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate
methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate (PubChem CID 68772342) has the molecular formula C16H11N3O3S
and a molecular weight of 325.35 g/mol. Its IUPAC name is methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate |
| PubChem CID | 68772342 |
| Molecular Formula | C16H11N3O3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1cc2ccc(Oc3nc4ncccc4s3)cc2[nH]1 |
| InChI | InChI=1S/C16H11N3O3S/c1-21-15(20)12-7-9-4-5-10(8-11(9)18-12)22-16-19-14-13(23-16)3-2-6-17-14/h2-8,18H,1H3 |
| InChIKey | CCXWSQCIXUTKNJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate?
The IUPAC name of methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate (CID 68772342) is methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate.
What is the SMILES notation for methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate?
The canonical SMILES for methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate is COC(=O)c1cc2ccc(Oc3nc4ncccc4s3)cc2[nH]1.
What is the InChIKey of methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate?
The InChIKey is CCXWSQCIXUTKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O3S/c1-21-15(20)12-7-9-4-5-10(8-11(9)18-12)22-16-19-14-13(23-16)3-2-6-17-14/h2-8,18H,1H3.
What are the key properties of methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate?
methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate has a molecular weight of 325.35 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1H-indole-2-carboxylate is sourced from PubChem (CID 68772342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).