C17H19BO4S — CID 58413829
1-hydroxy-6-[(2,4,6-trimethylphenyl)sulfonylmethyl]-3H-2,1-benzoxaborole (PubChem CID 58413829) has the molecular formula C17H19BO4S and a molecular weight of 330.21 g/mol. Its IUPAC name is 1-hydroxy-6-[(2,4,6-trimethylphenyl)sulfonylmethyl]-3H-2,1-benzoxaborole.
| Compound Name | 1-hydroxy-6-[(2,4,6-trimethylphenyl)sulfonylmethyl]-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 58413829 |
| Molecular Formula | C17H19BO4S |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-hydroxy-6-[(2,4,6-trimethylphenyl)sulfonylmethyl]-3H-2,1-benzoxaborole |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cc2ccc3c(c2)B(O)OC3)c(C)c1 |
| InChI | InChI=1S/C17H19BO4S/c1-11-6-12(2)17(13(3)7-11)23(20,21)10-14-4-5-15-9-22-18(19)16(15)8-14/h4-8,19H,9-10H2,1-3H3 |
| InChIKey | UDRGUMLNTXBUAN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|