C9H11NO — CID 156828600
5,7-dimethyl-1,3-dihydro-2,1-benzoxazole (PubChem CID 156828600) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 5,7-dimethyl-1,3-dihydro-2,1-benzoxazole.
| Compound Name | 5,7-dimethyl-1,3-dihydro-2,1-benzoxazole |
|---|---|
| PubChem CID | 156828600 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 5,7-dimethyl-1,3-dihydro-2,1-benzoxazole |
| SMILES | Cc1cc(C)c2c(c1)CON2 |
| InChI | InChI=1S/C9H11NO/c1-6-3-7(2)9-8(4-6)5-11-10-9/h3-4,10H,5H2,1-2H3 |
| InChIKey | OTOUMDNYBOYDJP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |