C14H19NO — CID 82113959
6,8-dimethyl-3-propan-2-yl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82113959) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 6,8-dimethyl-3-propan-2-yl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6,8-dimethyl-3-propan-2-yl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82113959 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 6,8-dimethyl-3-propan-2-yl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1cc(C)c2c(c1)CC(C(C)C)C(=O)N2 |
| InChI | InChI=1S/C14H19NO/c1-8(2)12-7-11-6-9(3)5-10(4)13(11)15-14(12)16/h5-6,8,12H,7H2,1-4H3,(H,15,16) |
| InChIKey | DVEMAXJILTVCOS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |