C16H21N3O2 — CID 122556871
(6aS,8R)-8-(dimethylamino)-2,4-dimethyl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (PubChem CID 122556871) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (6aS,8R)-8-(dimethylamino)-2,4-dimethyl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione.
| Compound Name | (6aS,8R)-8-(dimethylamino)-2,4-dimethyl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
|---|---|
| PubChem CID | 122556871 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (6aS,8R)-8-(dimethylamino)-2,4-dimethyl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES | Cc1cc(C)c2c(c1)C(=O)N1C[C@H](N(C)C)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C16H21N3O2/c1-9-5-10(2)14-12(6-9)16(21)19-8-11(18(3)4)7-13(19)15(20)17-14/h5-6,11,13H,7-8H2,1-4H3,(H,17,20)/t11-,13+/m1/s1 |
| InChIKey | MHOLUZNKSLQDJD-YPMHNXCESA-N |
| XLogP | 1.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |