C17H17N3O — CID 135817576
(3Z)-5,7-dimethyl-3-[methyl(phenyl)hydrazinylidene]-1H-indol-2-one (PubChem CID 135817576) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is (3Z)-5,7-dimethyl-3-[methyl(phenyl)hydrazinylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5,7-dimethyl-3-[methyl(phenyl)hydrazinylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 135817576 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (3Z)-5,7-dimethyl-3-[methyl(phenyl)hydrazinylidene]-1H-indol-2-one |
| SMILES | Cc1cc(C)c2c(c1)/C(=N/N(C)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C17H17N3O/c1-11-9-12(2)15-14(10-11)16(17(21)18-15)19-20(3)13-7-5-4-6-8-13/h4-10H,1-3H3,(H,18,19,21) |
| InChIKey | LWNQEFVZXLIBTE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|