C15H17N5O2S — CID 136518267
3-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxyimino]-5,7-dimethyl-1H-indol-2-one (PubChem CID 136518267) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is 3-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxyimino]-5,7-dimethyl-1H-indol-2-one.
| Compound Name | 3-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxyimino]-5,7-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 136518267 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxyimino]-5,7-dimethyl-1H-indol-2-one |
| SMILES | Cc1cc(C)c2c(c1)C(=NOCc1nsc(N(C)C)n1)C(=O)N2 |
| InChI | InChI=1S/C15H17N5O2S/c1-8-5-9(2)12-10(6-8)13(14(21)17-12)18-22-7-11-16-15(20(3)4)23-19-11/h5-6H,7H2,1-4H3,(H,17,18,21) |
| InChIKey | YHURZDQAMLSJDY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|