C17H21BFNO3 — CID 171112168
3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-5,7-dimethyl-1H-indol-2-one (PubChem CID 171112168) has the molecular formula C17H21BFNO3 and a molecular weight of 317.17 g/mol. Its IUPAC name is 3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-5,7-dimethyl-1H-indol-2-one.
| Compound Name | 3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-5,7-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 171112168 |
| Molecular Formula | C17H21BFNO3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-5,7-dimethyl-1H-indol-2-one |
| SMILES | Cc1cc(C)c2c(c1)C(=C(F)B1OC(C)(C)C(C)(C)O1)C(=O)N2 |
| InChI | InChI=1S/C17H21BFNO3/c1-9-7-10(2)13-11(8-9)12(15(21)20-13)14(19)18-22-16(3,4)17(5,6)23-18/h7-8H,1-6H3,(H,20,21) |
| InChIKey | LVYBGGNSSKKYIF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|