C19H23BF2N2O2 — CID 171112375
8-fluoro-10-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridine (PubChem CID 171112375) has the molecular formula C19H23BF2N2O2 and a molecular weight of 360.21 g/mol. Its IUPAC name is 8-fluoro-10-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridine.
| Compound Name | 8-fluoro-10-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridine |
|---|---|
| PubChem CID | 171112375 |
| Molecular Formula | C19H23BF2N2O2 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 8-fluoro-10-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridine |
| SMILES | CC1(C)OB(C(F)=C2C3=C(CCNC3)Nc3ccc(F)cc32)OC1(C)C |
| InChI | InChI=1S/C19H23BF2N2O2/c1-18(2)19(3,4)26-20(25-18)17(22)16-12-9-11(21)5-6-14(12)24-15-7-8-23-10-13(15)16/h5-6,9,23-24H,7-8,10H2,1-4H3 |
| InChIKey | NPPLEKXGTILGFL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|