C19H22BF2NO2 — CID 171112223
6-fluoro-1-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3,4,9-tetrahydrocarbazole (PubChem CID 171112223) has the molecular formula C19H22BF2NO2 and a molecular weight of 345.20 g/mol. Its IUPAC name is 6-fluoro-1-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3,4,9-tetrahydrocarbazole.
| Compound Name | 6-fluoro-1-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3,4,9-tetrahydrocarbazole |
|---|---|
| PubChem CID | 171112223 |
| Molecular Formula | C19H22BF2NO2 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 6-fluoro-1-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3,4,9-tetrahydrocarbazole |
| SMILES | CC1(C)OB(C(F)=C2CCCc3c2[nH]c2ccc(F)cc32)OC1(C)C |
| InChI | InChI=1S/C19H22BF2NO2/c1-18(2)19(3,4)25-20(24-18)17(22)13-7-5-6-12-14-10-11(21)8-9-15(14)23-16(12)13/h8-10,23H,5-7H2,1-4H3 |
| InChIKey | CSRSVZURMXVVQQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|