C18H22BF2NO3 — CID 171113486
6-fluoro-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]spiro[3H-chromene-2,3'-azetidine] (PubChem CID 171113486) has the molecular formula C18H22BF2NO3 and a molecular weight of 349.19 g/mol. Its IUPAC name is 6-fluoro-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]spiro[3H-chromene-2,3'-azetidine].
| Compound Name | 6-fluoro-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]spiro[3H-chromene-2,3'-azetidine] |
|---|---|
| PubChem CID | 171113486 |
| Molecular Formula | C18H22BF2NO3 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 6-fluoro-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]spiro[3H-chromene-2,3'-azetidine] |
| SMILES | CC1(C)OB(C(F)=C2CC3(CNC3)Oc3ccc(F)cc32)OC1(C)C |
| InChI | InChI=1S/C18H22BF2NO3/c1-16(2)17(3,4)25-19(24-16)15(21)13-8-18(9-22-10-18)23-14-6-5-11(20)7-12(13)14/h5-7,22H,8-10H2,1-4H3 |
| InChIKey | SPZACOKHERURPC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|