C20H26BClFNO3 — CID 171113481
6-chloro-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]spiro[3H-chromene-2,4'-piperidine] (PubChem CID 171113481) has the molecular formula C20H26BClFNO3 and a molecular weight of 393.70 g/mol. Its IUPAC name is 6-chloro-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]spiro[3H-chromene-2,4'-piperidine].
| Compound Name | 6-chloro-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]spiro[3H-chromene-2,4'-piperidine] |
|---|---|
| PubChem CID | 171113481 |
| Molecular Formula | C20H26BClFNO3 |
| Molecular Weight | 393.70 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 6-chloro-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]spiro[3H-chromene-2,4'-piperidine] |
| SMILES | CC1(C)OB(C(F)=C2CC3(CCNCC3)Oc3ccc(Cl)cc32)OC1(C)C |
| InChI | InChI=1S/C20H26BClFNO3/c1-18(2)19(3,4)27-21(26-18)17(23)15-12-20(7-9-24-10-8-20)25-16-6-5-13(22)11-14(15)16/h5-6,11,24H,7-10,12H2,1-4H3 |
| InChIKey | JZGAHUAVURWYTF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.70 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|