C20H26BFO3 — CID 171114452
2-[fluoro(spiro[3H-chromene-2,1'-cyclopentane]-4-ylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171114452) has the molecular formula C20H26BFO3 and a molecular weight of 344.24 g/mol. Its IUPAC name is 2-[fluoro(spiro[3H-chromene-2,1'-cyclopentane]-4-ylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[fluoro(spiro[3H-chromene-2,1'-cyclopentane]-4-ylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171114452 |
| Molecular Formula | C20H26BFO3 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-[fluoro(spiro[3H-chromene-2,1'-cyclopentane]-4-ylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=C2CC3(CCCC3)Oc3ccccc32)OC1(C)C |
| InChI | InChI=1S/C20H26BFO3/c1-18(2)19(3,4)25-21(24-18)17(22)15-13-20(11-7-8-12-20)23-16-10-6-5-9-14(15)16/h5-6,9-10H,7-8,11-13H2,1-4H3 |
| InChIKey | NBUBPGXYVNPHOS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|