C19H24BFO4 — CID 171113848
4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]spiro[3H-chromene-2,1'-cyclobutane]-5-ol (PubChem CID 171113848) has the molecular formula C19H24BFO4 and a molecular weight of 346.21 g/mol. Its IUPAC name is 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]spiro[3H-chromene-2,1'-cyclobutane]-5-ol.
| Compound Name | 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]spiro[3H-chromene-2,1'-cyclobutane]-5-ol |
|---|---|
| PubChem CID | 171113848 |
| Molecular Formula | C19H24BFO4 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]spiro[3H-chromene-2,1'-cyclobutane]-5-ol |
| SMILES | CC1(C)OB(C(F)=C2CC3(CCC3)Oc3cccc(O)c32)OC1(C)C |
| InChI | InChI=1S/C19H24BFO4/c1-17(2)18(3,4)25-20(24-17)16(21)12-11-19(9-6-10-19)23-14-8-5-7-13(22)15(12)14/h5,7-8,22H,6,9-11H2,1-4H3 |
| InChIKey | UCMGGFOCCYSUQF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|