C19H25BFNO4 — CID 171113490
4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-7-methoxyspiro[3H-chromene-2,3'-azetidine] (PubChem CID 171113490) has the molecular formula C19H25BFNO4 and a molecular weight of 361.22 g/mol. Its IUPAC name is 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-7-methoxyspiro[3H-chromene-2,3'-azetidine].
| Compound Name | 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-7-methoxyspiro[3H-chromene-2,3'-azetidine] |
|---|---|
| PubChem CID | 171113490 |
| Molecular Formula | C19H25BFNO4 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-7-methoxyspiro[3H-chromene-2,3'-azetidine] |
| SMILES | COc1ccc2c(c1)OC1(CNC1)CC2=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H25BFNO4/c1-17(2)18(3,4)26-20(25-17)16(21)14-9-19(10-22-11-19)24-15-8-12(23-5)6-7-13(14)15/h6-8,22H,9-11H2,1-5H3 |
| InChIKey | SKXNBIRCIMWNDH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|