C13H17NO3 — CID 82045910
7-methoxyspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-ol (PubChem CID 82045910) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 7-methoxyspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-ol.
| Compound Name | 7-methoxyspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-ol |
|---|---|
| PubChem CID | 82045910 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 7-methoxyspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-ol |
| SMILES | COc1ccc2c(c1)OC1(CCNC1)CC2O |
| InChI | InChI=1S/C13H17NO3/c1-16-9-2-3-10-11(15)7-13(4-5-14-8-13)17-12(10)6-9/h2-3,6,11,14-15H,4-5,7-8H2,1H3 |
| InChIKey | FCLSXDRKMAQHSB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |