C17H24O4 — CID 104948592
(4R)-7-methoxy-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-ol (PubChem CID 104948592) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (4R)-7-methoxy-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-ol.
| Compound Name | (4R)-7-methoxy-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-ol |
|---|---|
| PubChem CID | 104948592 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (4R)-7-methoxy-2'-propylspiro[3,4-dihydrochromene-2,4'-oxane]-4-ol |
| SMILES | CCCC1CC2(CCO1)C[C@@H](O)c1ccc(OC)cc1O2 |
| InChI | InChI=1S/C17H24O4/c1-3-4-13-10-17(7-8-20-13)11-15(18)14-6-5-12(19-2)9-16(14)21-17/h5-6,9,13,15,18H,3-4,7-8,10-11H2,1-2H3/t13?,15-,17?/m1/s1 |
| InChIKey | DPHVBZNCORNQFD-GNHJJJEISA-N |
| XLogP | 3.23 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |