C17H25NO3 — CID 104948786
(4S)-1'-ethyl-7-methoxyspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol (PubChem CID 104948786) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (4S)-1'-ethyl-7-methoxyspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol.
| Compound Name | (4S)-1'-ethyl-7-methoxyspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol |
|---|---|
| PubChem CID | 104948786 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (4S)-1'-ethyl-7-methoxyspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol |
| SMILES | CCN1CCCC2(CC1)C[C@H](O)c1ccc(OC)cc1O2 |
| InChI | InChI=1S/C17H25NO3/c1-3-18-9-4-7-17(8-10-18)12-15(19)14-6-5-13(20-2)11-16(14)21-17/h5-6,11,15,19H,3-4,7-10,12H2,1-2H3/t15-,17?/m0/s1 |
| InChIKey | VNXUDQMQAFIRHV-MYJWUSKBSA-N |
| XLogP | 2.76 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |