C26H33NO4 — CID 51503842
(4S)-1'-[(2S)-2-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-7-methoxyspiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol (PubChem CID 51503842) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is (4S)-1'-[(2S)-2-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-7-methoxyspiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol.
| Compound Name | (4S)-1'-[(2S)-2-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-7-methoxyspiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol |
|---|---|
| PubChem CID | 51503842 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (4S)-1'-[(2S)-2-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-7-methoxyspiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol |
| SMILES | COc1ccc2c(c1)OC1(CCN(C[C@@H](O)c3ccc4c(c3)CCCC4)CC1)C[C@@H]2O |
| InChI | InChI=1S/C26H33NO4/c1-30-21-8-9-22-23(28)16-26(31-25(22)15-21)10-12-27(13-11-26)17-24(29)20-7-6-18-4-2-3-5-19(18)14-20/h6-9,14-15,23-24,28-29H,2-5,10-13,16-17H2,1H3/t23-,24+/m0/s1 |
| InChIKey | OVCVEWHEMTXRCE-BJKOFHAPSA-N |
| XLogP | 3.96 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |