C25H31NO4 — CID 46966092
1'-[2-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]spiro[3,4-dihydrochromene-2,4'-piperidine]-4,6-diol (PubChem CID 46966092) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1'-[2-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]spiro[3,4-dihydrochromene-2,4'-piperidine]-4,6-diol.
| Compound Name | 1'-[2-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]spiro[3,4-dihydrochromene-2,4'-piperidine]-4,6-diol |
|---|---|
| PubChem CID | 46966092 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 1'-[2-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]spiro[3,4-dihydrochromene-2,4'-piperidine]-4,6-diol |
| SMILES | Oc1ccc2c(c1)C(O)CC1(CCN(CC(O)c3ccc4c(c3)CCCC4)CC1)O2 |
| InChI | InChI=1S/C25H31NO4/c27-20-7-8-24-21(14-20)22(28)15-25(30-24)9-11-26(12-10-25)16-23(29)19-6-5-17-3-1-2-4-18(17)13-19/h5-8,13-14,22-23,27-29H,1-4,9-12,15-16H2 |
| InChIKey | DIPNPKADAGYUON-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |