C25H31NO3 — CID 51503836
(4R)-1'-[(2S)-2-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]spiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol (PubChem CID 51503836) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is (4R)-1'-[(2S)-2-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]spiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol.
| Compound Name | (4R)-1'-[(2S)-2-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]spiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol |
|---|---|
| PubChem CID | 51503836 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (4R)-1'-[(2S)-2-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]spiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol |
| SMILES | O[C@H](CN1CCC2(CC1)C[C@@H](O)c1ccccc1O2)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C25H31NO3/c27-22-16-25(29-24-8-4-3-7-21(22)24)11-13-26(14-12-25)17-23(28)20-10-9-18-5-1-2-6-19(18)15-20/h3-4,7-10,15,22-23,27-28H,1-2,5-6,11-14,16-17H2/t22-,23-/m1/s1 |
| InChIKey | OXSDXEJQZORRNL-DHIUTWEWSA-N |
| XLogP | 3.95 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |