C16H20BBrFNO2 — CID 171112823
6-bromo-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3-dihydro-1H-isoquinoline (PubChem CID 171112823) has the molecular formula C16H20BBrFNO2 and a molecular weight of 368.06 g/mol. Its IUPAC name is 6-bromo-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3-dihydro-1H-isoquinoline.
| Compound Name | 6-bromo-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 171112823 |
| Molecular Formula | C16H20BBrFNO2 |
| Molecular Weight | 368.06 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 6-bromo-4-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3-dihydro-1H-isoquinoline |
| SMILES | CC1(C)OB(C(F)=C2CNCc3ccc(Br)cc32)OC1(C)C |
| InChI | InChI=1S/C16H20BBrFNO2/c1-15(2)16(3,4)22-17(21-15)14(19)13-9-20-8-10-5-6-11(18)7-12(10)13/h5-7,20H,8-9H2,1-4H3 |
| InChIKey | MNJBUTODFLNYDB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.06 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|