C17H21BBrFO2 — CID 171114166
2-[[2-(3-bromophenyl)cyclobutylidene]-fluoromethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171114166) has the molecular formula C17H21BBrFO2 and a molecular weight of 367.07 g/mol. Its IUPAC name is 2-[[2-(3-bromophenyl)cyclobutylidene]-fluoromethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[[2-(3-bromophenyl)cyclobutylidene]-fluoromethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171114166 |
| Molecular Formula | C17H21BBrFO2 |
| Molecular Weight | 367.07 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-[[2-(3-bromophenyl)cyclobutylidene]-fluoromethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=C2CCC2c2cccc(Br)c2)OC1(C)C |
| InChI | InChI=1S/C17H21BBrFO2/c1-16(2)17(3,4)22-18(21-16)15(20)14-9-8-13(14)11-6-5-7-12(19)10-11/h5-7,10,13H,8-9H2,1-4H3 |
| InChIKey | XPJUYLISLJXAIO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.07 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|