C18H23BF2O2 — CID 171114411
2-[fluoro-[2-(4-fluorophenyl)cyclopentylidene]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171114411) has the molecular formula C18H23BF2O2 and a molecular weight of 320.19 g/mol. Its IUPAC name is 2-[fluoro-[2-(4-fluorophenyl)cyclopentylidene]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[fluoro-[2-(4-fluorophenyl)cyclopentylidene]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171114411 |
| Molecular Formula | C18H23BF2O2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-[fluoro-[2-(4-fluorophenyl)cyclopentylidene]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=C2CCCC2c2ccc(F)cc2)OC1(C)C |
| InChI | InChI=1S/C18H23BF2O2/c1-17(2)18(3,4)23-19(22-17)16(21)15-7-5-6-14(15)12-8-10-13(20)11-9-12/h8-11,14H,5-7H2,1-4H3 |
| InChIKey | VGTXDZOLOWCZHX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|