C18H22BFO4 — CID 171112641
4-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]benzoic acid (PubChem CID 171112641) has the molecular formula C18H22BFO4 and a molecular weight of 332.18 g/mol. Its IUPAC name is 4-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]benzoic acid.
| Compound Name | 4-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]benzoic acid |
|---|---|
| PubChem CID | 171112641 |
| Molecular Formula | C18H22BFO4 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 4-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]benzoic acid |
| SMILES | CC1(C)OB(C(F)=C2CC(c3ccc(C(=O)O)cc3)C2)OC1(C)C |
| InChI | InChI=1S/C18H22BFO4/c1-17(2)18(3,4)24-19(23-17)15(20)14-9-13(10-14)11-5-7-12(8-6-11)16(21)22/h5-8,13H,9-10H2,1-4H3,(H,21,22)/b15-14- |
| InChIKey | YZUFNPLQMNQPQY-PFONDFGASA-N |
| XLogP | 4.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|