C16H24BFN2O3 — CID 171113666
3-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-5-propan-2-yl-1,2,4-oxadiazole (PubChem CID 171113666) has the molecular formula C16H24BFN2O3 and a molecular weight of 322.19 g/mol. Its IUPAC name is 3-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-5-propan-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-5-propan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 171113666 |
| Molecular Formula | C16H24BFN2O3 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 3-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-5-propan-2-yl-1,2,4-oxadiazole |
| SMILES | CC(C)c1nc(C2CC(=C(F)B3OC(C)(C)C(C)(C)O3)C2)no1 |
| InChI | InChI=1S/C16H24BFN2O3/c1-9(2)14-19-13(20-21-14)11-7-10(8-11)12(18)17-22-15(3,4)16(5,6)23-17/h9,11H,7-8H2,1-6H3/b12-10- |
| InChIKey | PWUJFKLCFLVOLD-BENRWUELSA-N |
| XLogP | 3.93 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|