C9H14N2O4S — CID 115079891
1-[3-(1,1-dioxothian-4-yl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 115079891) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 1-[3-(1,1-dioxothian-4-yl)-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | 1-[3-(1,1-dioxothian-4-yl)-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 115079891 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 1-[3-(1,1-dioxothian-4-yl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | CC(O)c1nc(C2CCS(=O)(=O)CC2)no1 |
| InChI | InChI=1S/C9H14N2O4S/c1-6(12)9-10-8(11-15-9)7-2-4-16(13,14)5-3-7/h6-7,12H,2-5H2,1H3 |
| InChIKey | ZXEMQPHIYGNYHK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |