C15H24N2O2 — CID 80610154
2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)pentan-3-one (PubChem CID 80610154) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)pentan-3-one.
| Compound Name | 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)pentan-3-one |
|---|---|
| PubChem CID | 80610154 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)pentan-3-one |
| SMILES | CCC(=O)C(C)c1nc(C2CCCCCCC2)no1 |
| InChI | InChI=1S/C15H24N2O2/c1-3-13(18)11(2)15-16-14(17-19-15)12-9-7-5-4-6-8-10-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | VHGMMPXEDFCAHA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |