C14H24N4O2 — CID 119817400
3-amino-N-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]butanamide (PubChem CID 119817400) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-amino-N-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]butanamide.
| Compound Name | 3-amino-N-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 119817400 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 3-amino-N-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]butanamide |
| SMILES | CC(N)CC(=O)NC(C)c1nc(C2CCCCC2)no1 |
| InChI | InChI=1S/C14H24N4O2/c1-9(15)8-12(19)16-10(2)14-17-13(18-20-14)11-6-4-3-5-7-11/h9-11H,3-8,15H2,1-2H3,(H,16,19) |
| InChIKey | GYSRUDBBTYWGJF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |