C8H13N3O — CID 104880933
(1R)-1-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 104880933) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is (1R)-1-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)ethanamine.
| Compound Name | (1R)-1-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 104880933 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (1R)-1-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | C[C@@H](N)c1nc(C2CCC2)no1 |
| InChI | InChI=1S/C8H13N3O/c1-5(9)8-10-7(11-12-8)6-3-2-4-6/h5-6H,2-4,9H2,1H3/t5-/m1/s1 |
| InChIKey | KJYZVSKUWZWLQB-RXMQYKEDSA-N |
| XLogP | 1.36 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |