About (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine
(3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine (PubChem CID 65389317) has the molecular formula C16H27N3O
and a molecular weight of 277.41 g/mol. Its IUPAC name is (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine.
Molecular Properties
| Compound Name | (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine |
| PubChem CID | 65389317 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine |
| SMILES | NC(c1nc(C2CCCCCC2)no1)C1CCCCC1 |
| InChI | InChI=1S/C16H27N3O/c17-14(12-8-6-3-7-9-12)16-18-15(19-20-16)13-10-4-1-2-5-11-13/h12-14H,1-11,17H2 |
| InChIKey | HBKGLNYPGDJUGB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine?
The IUPAC name of (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine (CID 65389317) is (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine.
What is the SMILES notation for (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine?
The canonical SMILES for (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine is NC(c1nc(C2CCCCCC2)no1)C1CCCCC1.
What is the InChIKey of (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine?
The InChIKey is HBKGLNYPGDJUGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O/c17-14(12-8-6-3-7-9-12)16-18-15(19-20-16)13-10-4-1-2-5-11-13/h12-14H,1-11,17H2.
What are the key properties of (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine?
(3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine has a molecular weight of 277.41 g/mol, XLogP of 4.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cycloheptyl-1,2,4-oxadiazol-5-yl)-cyclohexylmethanamine is sourced from PubChem (CID 65389317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).