About (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine
(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine (PubChem CID 115285024) has the molecular formula C15H21N3OS
and a molecular weight of 291.42 g/mol. Its IUPAC name is (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine.
Molecular Properties
| Compound Name | (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine |
| PubChem CID | 115285024 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine |
| SMILES | NC(c1nc(C2CCCCCCC2)no1)c1cccs1 |
| InChI | InChI=1S/C15H21N3OS/c16-13(12-9-6-10-20-12)15-17-14(18-19-15)11-7-4-2-1-3-5-8-11/h6,9-11,13H,1-5,7-8,16H2 |
| InChIKey | KXGPSWYPCQTVDF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine?
The IUPAC name of (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine (CID 115285024) is (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine.
What is the SMILES notation for (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine?
The canonical SMILES for (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine is NC(c1nc(C2CCCCCCC2)no1)c1cccs1.
What is the InChIKey of (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine?
The InChIKey is KXGPSWYPCQTVDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3OS/c16-13(12-9-6-10-20-12)15-17-14(18-19-15)11-7-4-2-1-3-5-8-11/h6,9-11,13H,1-5,7-8,16H2.
What are the key properties of (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine?
(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine has a molecular weight of 291.42 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyclooctyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine is sourced from PubChem (CID 115285024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).