C12H21N3O2 — CID 104915877
(2S)-2-amino-2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)ethanol (PubChem CID 104915877) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is (2S)-2-amino-2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)ethanol.
| Compound Name | (2S)-2-amino-2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 104915877 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | (2S)-2-amino-2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)ethanol |
| SMILES | N[C@@H](CO)c1nc(C2CCCCCCC2)no1 |
| InChI | InChI=1S/C12H21N3O2/c13-10(8-16)12-14-11(15-17-12)9-6-4-2-1-3-5-7-9/h9-10,16H,1-8,13H2/t10-/m0/s1 |
| InChIKey | BNGCGAMEQLKQHB-JTQLQIEISA-N |
| XLogP | 1.89 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |