C15H24N2O3 — CID 103500634
3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid (PubChem CID 103500634) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid.
| Compound Name | 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 103500634 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid |
| SMILES | CC(C(=O)O)C(C)c1nc(C2CCCCCCC2)no1 |
| InChI | InChI=1S/C15H24N2O3/c1-10(11(2)15(18)19)14-16-13(17-20-14)12-8-6-4-3-5-7-9-12/h10-12H,3-9H2,1-2H3,(H,18,19) |
| InChIKey | CQLWSFLNIBJKQB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |