3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid

C15H24N2O3 — CID 103500634

IUPAC3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid
SMILESCC(C(=O)O)C(C)c1nc(C2CCCCCCC2)no1
InChIInChI=1S/C15H24N2O3/c1-10(11(2)15(18)19)14-16-13(17-20-14)12-8-6-4-3-5-7-9-12/h10-12H,3-9H2,1-2H3,(H,18,19)
InChIKeyCQLWSFLNIBJKQB-UHFFFAOYSA-N
MW280.37 g/mol
LogP3.72
Rot. Bonds4

About 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid

3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid (PubChem CID 103500634) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid.

Molecular Properties

Compound Name3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid
PubChem CID103500634
Molecular FormulaC15H24N2O3
Molecular Weight280.37 g/mol
Exact Mass280.18
IUPAC Name3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid
SMILESCC(C(=O)O)C(C)c1nc(C2CCCCCCC2)no1
InChIInChI=1S/C15H24N2O3/c1-10(11(2)15(18)19)14-16-13(17-20-14)12-8-6-4-3-5-7-9-12/h10-12H,3-9H2,1-2H3,(H,18,19)
InChIKeyCQLWSFLNIBJKQB-UHFFFAOYSA-N
XLogP3.72
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.37
LogP ≤ 53.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid?
The IUPAC name of 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid (CID 103500634) is 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid.
What is the SMILES notation for 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid?
The canonical SMILES for 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid is CC(C(=O)O)C(C)c1nc(C2CCCCCCC2)no1.
What is the InChIKey of 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid?
The InChIKey is CQLWSFLNIBJKQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O3/c1-10(11(2)15(18)19)14-16-13(17-20-14)12-8-6-4-3-5-7-9-12/h10-12H,3-9H2,1-2H3,(H,18,19).
What are the key properties of 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid?
3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid has a molecular weight of 280.37 g/mol, XLogP of 3.72, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid is sourced from PubChem (CID 103500634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).