C11H18N2O2 — CID 66263723
(1S)-1-[3-(4-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 66263723) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (1S)-1-[3-(4-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | (1S)-1-[3-(4-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 66263723 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (1S)-1-[3-(4-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | CC1CCC(c2noc([C@H](C)O)n2)CC1 |
| InChI | InChI=1S/C11H18N2O2/c1-7-3-5-9(6-4-7)10-12-11(8(2)14)15-13-10/h7-9,14H,3-6H2,1-2H3/t7?,8-,9?/m0/s1 |
| InChIKey | UJSDMMPHYIWXSV-MGURRDGZSA-N |
| XLogP | 2.42 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |